1-Acetyl-4-(4-hydroxyphenyl)piperazine is a piperazine-based heterocyclic compound featuring an acetyl group at the 1-position and a 4-hydroxyphenyl substituent at position 4. The hydroxyl group on the aromatic ring enables hydrogen bonding, while the acetyl moiety introduces an ester functionality. This impurity likely arises during acetylation or coupling reactions in the synthesis of the parent API, where piperazine serves as a core scaffold. Its structural similarity to the parent drug allows it to act as a critical HPLC reference standard for impurity profiling in pharmaceutical quality control.
On RequestCC(=O)N1CCN(CC1)C2=CC=C(C=C2)O
InChI=1S/C12H16N2O2/c1-10(15)13-6-8-14(9-7-13)11-2-4-12(16)5-3-11/h2-5,16H,6-9H2,1H3
AGVNLFCRZULMKK-UHFFFAOYSA-N