3,5-Dimethyl-2-pyridinemethanol is a substituted pyridine derivative featuring a six-membered aromatic ring with methyl substituents at the 3- and 5-positions and a hydroxymethyl group at position 2. The molecule exhibits a hybrid structure combining pyridine's nitrogen heteroatom with secondary alcohol functionality, enabling participation in hydrogen bonding and nucleophilic interactions. As an API impurity, it arises from side-chain oxidation pathways during parent drug synthesis, retaining core pyridine architecture with steric hindrance from dimethyl substitution. This compound serves as a critical HPLC reference standard for quantifying process-related impurities in pharmaceutical development.
On RequestCC1=CN=C(C(=C1OC)C)CO
InChI=1S/C9H13NO2/c1-6-4-10-8(5-11)7(2)9(6)12-3/h4,11H,5H2,1-3H3
PSEPRWKZZJWRCB-UHFFFAOYSA-N