6-Methyl Resperidone is a structurally modified derivative of Resperidone, characterized by a methyl substitution at the 6-position of the piperidine ring. This compound retains the core benzisoxazole and dibenzothiazepine frameworks of the parent drug but exhibits altered steric and electronic properties due to the methyl group. The molecule contains a tertiary amino functionality, a thiazepine heterocycle, and a fluorinated aromatic ring. Its structural divergence from Resperidone arises from a methylation event during synthetic pathways, leading to reduced pharmacological activity. This compound serves as a critical HPLC reference standard for quantifying process-related impurities in Resperidone formulations.
On Request| Std | Catalog # | Quantity | Price |
|---|---|---|---|
| USP | 1A11830 โ | 25 mg | USD 975.00 |
CC1CCCC2=NC(=C(C(=O)N12)CCN3CCC(CC3)C4=NOC5=C4C=CC(=C5)F)C
InChI=1S/C24H29FN4O2/c1-15-4-3-5-22-26-16(2)19(24(30)29(15)22)10-13-28-11-8-17(9-12-28)23-20-7-6-18(25)14-21(20)31-27-23/h6-7,14-15,17H,3-5,8-13H2,1-2H3
OGYZXUJCZWNPPY-UHFFFAOYSA-N