Mirabegron EP impurity E (CAS: 24954-67-4) is structurally identified as 2-amino-N-(4-hydroxy-3-(hydroxymethyl)phenyl)acetamide. This compound is an impurity of Mirabegron, resulting from potential oxidative or hydrolytic degradation pathways involving the parent drug's amide bond. Compared to Mirabegron, it notably lacks the 2-(2-aminothiazol-4-yl)acetic acid moiety, featuring instead a simple primary amide directly linked to a di-substituted phenyl ring containing both a hydroxyl and a hydroxymethyl group. Its distinct structure makes it critical for chromatographic purity assessments of Mirabegron active pharmaceutical ingredient.
On Request[N+](=O)([O-])C1=CC=C(C=C1)CCN
InChI=1S/C8H10N2O2/c9-6-5-7-1-3-8(4-2-7)10(11)12/h1-4H,5-6,9H2
IOXOZOPLBFXYLM-UHFFFAOYSA-N