Chlorphenamine Impurity C is a synthetic byproduct arising from incomplete N-methylation during the synthesis of the parent antihistamine. Its structure features a 4-chloro-ฮฑ-phenylbenzeneethanamine scaffold with a mono-N-methylated amine group, distinguishing it from the fully N,N-dimethylated chlorphenamine. The compound retains the core aromatic and aliphatic moieties but lacks one methyl group on the terminal amine, leading to altered physicochemical properties. This impurity serves as a critical HPLC reference standard for quantifying process-related deviations in chlorphenamine manufacturing.
On Request| Std | Catalog # | Quantity | Price |
|---|---|---|---|
| EP | Y0000437 โ | 15 MG | EUR 90.00 |
CNCCC(C1=CC=C(C=C1)Cl)C2=CC=CC=N2
InChI=1S/C15H17ClN2/c1-17-11-9-14(15-4-2-3-10-18-15)12-5-7-13(16)8-6-12/h2-8,10,14,17H,9,11H2,1H3
UICFCNIVUDNZSW-UHFFFAOYSA-N