Cyclobenzaprine USP RC B (Nortriptyline Impurity B) is a structurally related impurity derived from the parent drug cyclobenzaprine through a demethylation process, featuring a 1-cyclohexyl-3,4-dihydro-1,5-benzodiazepine-2,4-dione scaffold with a chloro substituent at the 10-position and a desmethylated amine functionality. This compound retains the core benzodiazepine ring system but exhibits altered substituents at the nitrogen center, leading to distinct chromatographic and spectroscopic profiles. It serves as a critical HPLC reference standard for quantifying this specific degradation byproduct in cyclobenzaprine formulations.
On Request| Std | Catalog # | Quantity | Price |
|---|---|---|---|
| USP | 1154525 โ | 10 mg | USD 903.00 |
CNCCC=C1C2=CC=CC=C2C=CC3=CC=CC=C31.Cl
InChI=1S/C19H19N.ClH/c1-20-14-6-11-19-17-9-4-2-7-15(17)12-13-16-8-3-5-10-18(16)19;/h2-5,7-13,20H,6,14H2,1H3;1H
UZMPCPFDZYTEJG-UHFFFAOYSA-N