Dolutegravir Acid is a benzylcarboxylic acid derivative featuring a 5,6-dihydro-4H-pyran-4-one core linked to a substituted phenyl ring and a cyclopropylmethylamino side chain. Its structure retains key pharmacophoric elements of dolutegravir but incorporates a terminal carboxylic acid group, likely formed via oxidative degradation of the parent drug's ester functionality. This impurity arises during synthetic pathways or storage under acidic conditions, serving as a critical HPLC reference standard for quantifying process-related degradation in API batches.
On RequestOC=1C(C(=CN2C[C@@H]3OCC[C@@H](N3C(C21)=O)C)C(=O)O)=O
InChI=1S/C13H14N2O6/c1-6-2-3-21-8-5-14-4-7(13(19)20)10(16)11(17)9(14)12(18)15(6)8/h4,6,8,17H,2-3,5H2,1H3,(H,19,20)/t6-,8-/m0/s1
KVXRWTBFPVMIGC-XPUUQOCRSA-N