Empagliflozin Intermediat 1 is a bromochlorinated aromatic ester derivative featuring a substituted benzene ring with ortho-oriented bromine and chlorine substituents, linked to a tetrahydrofuran-based ester moiety. Its structure incorporates key functional groups essential for the convergent synthesis of empagliflozin, serving as a critical precursor in the formation of the drugโs core scaffold. This intermediate is specifically employed as an HPLC reference standard for impurity profiling during empagliflozin API process validation.
On RequestC1=CC(=CC=C1C(=O)C2=C(C=CC(=C2)Br)Cl)O
InChI=1S/C13H8BrClO2/c14-9-3-6-12(15)11(7-9)13(17)8-1-4-10(16)5-2-8/h1-7,16H
BSKHBYQWMYSDHW-UHFFFAOYSA-N