Ipratropium Impurity B is a quaternary ammonium derivative structurally related to ipratropium bromide, featuring a tropane ring system substituted with a 2-hydroxy-3-naphthoyl ester group and a bromide counterion. Its distinct configuration arises from a synthetic byproduct formed during esterification, where a hydroxyl group undergoes partial oxidation, introducing a carbonyl moiety adjacent to the naphthalene ring. This impurity exhibits altered steric hindrance compared to the parent drug, affecting its cholinergic receptor affinity. It serves as an HPLC reference standard for quantifying process-related impurities in ipratropium formulations.
On Request| Std | Catalog # | Quantity | Price |
|---|---|---|---|
| EP | I0361000 โ | 15 MG | EUR 90.00 |
| USP | 1347529 โ | 10 mg | USD 903.00 |
CC(C)[N+]1(C2CCC1CC(C2)OC(=O)C(CO)C3=CC=CC=C3)C.[Br-]
InChI=1S/C20H30NO3.BrH/c1-14(2)21(3)16-9-10-17(21)12-18(11-16)24-20(23)19(13-22)15-7-5-4-6-8-15;/h4-8,14,16-19,22H,9-13H2,1-3H3;1H/q+1;/p-1
LHLMOSXCXGLMMN-UHFFFAOYSA-M