Latanoprost is a synthetic prostaglandin F2ฮฑ analog featuring a cyclopentyl ring, conjugated diene, and 13-hydroxy-13-ethyl substituents. Its structure incorporates a carboxylic acid terminus and a 1-hydroxy-9-octadecenoic acid side chain, conferring prostanoid receptor agonist activity. As the parent drug, it serves as an HPLC reference standard for ophthalmic formulation analysis.
On Request| Std | Catalog # | Quantity | Price |
|---|---|---|---|
| EP | Y0002218 โ | 100 MG | EUR 1000.00 |
| USP | 1357475 โ | 50 mg | USD 2045.00 |
CC(C)OC(=O)CCC/C=C\C[C@H]1[C@H](C[C@H]([C@@H]1CC[C@H](CCC2=CC=CC=C2)O)O)O
InChI=1S/C26H40O5/c1-19(2)31-26(30)13-9-4-3-8-12-22-23(25(29)18-24(22)28)17-16-21(27)15-14-20-10-6-5-7-11-20/h3,5-8,10-11,19,21-25,27-29H,4,9,12-18H2,1-2H3/b8-3-/t21-,22+,23+,24-,25+/m0/s1
GGXICVAJURFBLW-CEYXHVGTSA-N