Mebeverine Acid is a structural analogue of Mebeverine, distinguished by the presence of a carboxylic acid functional group, which imparts distinct chemical properties. Its chemical structure is characterized by a specific arrangement of functional groups, including an ether linkage and a substituted benzene ring. This compound serves as a critical API impurity reference standard for HPLC analysis.
On RequestCCN(CCCC(=O)O)C(C)CC1=CC=C(C=C1)OC
InChI=1S/C16H25NO3/c1-4-17(11-5-6-16(18)19)13(2)12-14-7-9-15(20-3)10-8-14/h7-10,13H,4-6,11-12H2,1-3H3,(H,18,19)
UZUWRVLVHOYTNN-UHFFFAOYSA-N