Metformin EP Impurity C features a distinct structural motif, with a guanidine core and appended alkyl chains, differing from metformin by a specific functional group substitution, rendering it a unique impurity with distinct chemical properties. It serves as a reference standard for HPLC analysis.
On Request| Std | Catalog # | Quantity | Price |
|---|---|---|---|
| USP | 1396342 โ | 25 mg | USD 921.00 |
CN(C)C1=NC(=NC(=N1)N)N
InChI=1S/C5H10N6/c1-11(2)5-9-3(6)8-4(7)10-5/h1-2H3,(H4,6,7,8,9,10)
IEFWDQQGFDLKFK-UHFFFAOYSA-N