N-Acetyl-S-(3-hydroxypropyl)cysteine is a cysteine derivative featuring an N-acetyl group, a thiolate sulfur linked to a 3-hydroxypropyl chain, and a terminal hydroxyl group. Its structure incorporates both hydrophilic (hydroxyl) and lipophilic (acetyl) moieties, conferring moderate polarity. This compound arises as a synthetic byproduct during acetylation processes of thiol-containing APIs, where side-chain hydroxylation occurs. The 3-hydroxypropyl substitution introduces steric hindrance, influencing reactivity and stability. Utilized as an HPLC reference standard for quantifying process-related impurities in cysteine-based pharmaceuticals.
On RequestCC(=O)N[C@@H](CSCCCO)C(=O)O
InChI=1S/C8H15NO4S/c1-6(11)9-7(8(12)13)5-14-4-2-3-10/h7,10H,2-5H2,1H3,(H,9,11)(H,12,13)/t7-/m0/s1
FMWPQZPFBAHHMB-ZETCQYMHSA-N