N-Acetyl-S-(trichlorovinyl)-L-cysteine is a thiol-containing cysteine derivative featuring an N-acetyl group and a trichlorovinyl moiety attached to the sulfur atom. Its structure incorporates a chiral L-configuration, a deprotonated thiolate group, and a conjugated trichloroethylene framework. This compound arises as a specific degradation byproduct of related organochlorine-containing pharmaceuticals. It serves as a critical HPLC reference standard for quantifying process-related impurities in acetylcysteine-based drug substances.
On Request| Std | Catalog # | Quantity | Price |
|---|---|---|---|
| EP | A0150000 โ | 50 MG | EUR 90.00 |
| USP | 1009005 โ | 200 mg | USD 283.00 |
CC(=O)N[C@@H](CS)C(=O)O
InChI=1S/C5H9NO3S/c1-3(7)6-4(2-10)5(8)9/h4,10H,2H2,1H3,(H,6,7)(H,8,9)/t4-/m0/s1
PWKSKIMOESPYIA-BYPYZUCNSA-N