Nitazoxanide Impurity 1 exhibits a distinct structural configuration, featuring a thiazole ring and an acetamide functional group, differing from its parent compound by a specific modification. Its chemical relationship to Nitazoxanide is characterized by a unique degradation pathway. It serves as a critical reference standard for HPLC analysis.
On RequestCC(=O)OC1=CC=CC=C1C(=O)NC2=NC=CS2
InChI=1S/C12H10N2O3S/c1-8(15)17-10-5-3-2-4-9(10)11(16)14-12-13-6-7-18-12/h2-7H,1H3,(H,13,14,16)
GXWWYCHNNUHFAL-UHFFFAOYSA-N