Nitroglycerin is a trinitrated glycerol derivative featuring three nitrate ester functional groups attached to the 1,3,5-positions of a propane-1,2,3-triol core. Its molecular architecture imparts high energetic potential due to the electron-withdrawing nitro groups, which stabilize the molecule through conjugation. As the fully nitrated analog of 1,3-Dinitroglycerin, it represents the oxidation limit of glycerol-based nitrate esters. The compound serves as a critical reference material for calibrating explosive detection systems and quantifying nitrate ester content in propellant formulations via gas chromatography-mass spectrometry.
On Request| Std | Catalog # | Quantity | Price |
|---|---|---|---|
| USP | 1213159 โ | 2 mL | USD 853.00 |
C(C(CO[N+](=O)[O-])O)O[N+](=O)[O-]
InChI=1S/C3H6N2O7/c6-3(1-11-4(7)8)2-12-5(9)10/h3,6H,1-2H2
ASIGVDLTBLZXNC-UHFFFAOYSA-N