O-Desmethyl galantamine is a tropane alkaloid derivative characterized by a bicyclic tropane skeleton substituted with a hydroxyl group at the oxygen site and an amide functionality at the nitrogen. This compound represents a demethylated analog of galantamine, lacking the methyl group on the oxygen atom of the parent structure, which alters its pharmacophoric properties. The absence of the methyl substituent introduces a polar hydroxyl moiety, enhancing hydrogen bonding potential while reducing steric bulk. It serves as a critical HPLC reference standard for quantifying process-related impurities in galantamine synthesis.
On RequestCN1CC[C@@]23C=C[C@@H](C[C@@H]2OC4=C(C=CC(=C34)C1)O)O
InChI=1S/C16H19NO3/c1-17-7-6-16-5-4-11(18)8-13(16)20-15-12(19)3-2-10(9-17)14(15)16/h2-5,11,13,18-19H,6-9H2,1H3/t11-,13-,16-/m0/s1
OYSGWKOGUVOGFQ-RBOXIYTFSA-N