Propafenone impurity C features a distinct structural motif, with a phenyl ring and an ether linkage, differing from the parent drug by a specific functional group modification. Its chemical structure is characterized by the presence of a hydroxyl group and an alkyl chain. This compound serves as a critical reference standard for HPLC analysis.
On Request| Std | Catalog # | Quantity | Price |
|---|---|---|---|
| USP | 1A09950 โ | 25 mg | USD 525.00 |
C1C(O1)COC2=CC=CC=C2C(=O)CCC3=CC=CC=C3
InChI=1S/C18H18O3/c19-17(11-10-14-6-2-1-3-7-14)16-8-4-5-9-18(16)21-13-15-12-20-15/h1-9,15H,10-13H2
AUZMQKJKLUZHBY-UHFFFAOYSA-N