N,N'-Diacetyl Cystine is a disulfide-bridged dimer of acetylated cysteine residues, featuring two acetyl groups appended to the ฮต-amino functionalities of each cysteine unit. This derivative exhibits a fully oxidized disulfide linkage (S-S) and retains the inherent thiol reactivity of cystine in a masked amino state. Structurally, it represents a cystine analog with enhanced thermal stability due to N-acylation, which sterically hinders oxidative degradation pathways. Synthetically, it serves as a critical HPLC reference standard for quantifying acetylation-related impurities in cystine API synthesis.
On Request| Std | Catalog # | Quantity | Price |
|---|---|---|---|
| EP | A0152000 โ | 10 MG | EUR 90.00 |
| USP | 1009038 โ | 20 mg | USD 800.00 |
CC(=O)N[C@@H](CSSC[C@@H](C(=O)O)NC(=O)C)C(=O)O
InChI=1S/C10H16N2O6S2/c1-5(13)11-7(9(15)16)3-19-20-4-8(10(17)18)12-6(2)14/h7-8H,3-4H2,1-2H3,(H,11,13)(H,12,14)(H,15,16)(H,17,18)/t7-,8-/m0/s1
YTPQSLLEROSACP-YUMQZZPRSA-N